C34H45N7O8S — CID 10055610
tert-butyl N-[(2S)-1-[[(2S,3S)-1-cyclohexyl-3-hydroxy-6-pyridin-2-ylsulfanylhexan-2-yl]amino]-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 10055610) has the molecular formula C34H45N7O8S and a molecular weight of 711.84 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S,3S)-1-cyclohexyl-3-hydroxy-6-pyridin-2-ylsulfanylhexan-2-yl]amino]-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S,3S)-1-cyclohexyl-3-hydroxy-6-pyridin-2-ylsulfanylhexan-2-yl]amino]-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10055610 |
| Molecular Formula | C34H45N7O8S |
| Molecular Weight | 711.84 g/mol |
| Exact Mass | 711.31 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S,3S)-1-cyclohexyl-3-hydroxy-6-pyridin-2-ylsulfanylhexan-2-yl]amino]-3-[3-(2,4-dinitrophenyl)imidazol-4-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cncn1-c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)CCCSc1ccccn1 |
| InChI | InChI=1S/C34H45N7O8S/c1-34(2,3)49-33(44)38-27(19-25-21-35-22-39(25)28-15-14-24(40(45)46)20-29(28)41(47)48)32(43)37-26(18-23-10-5-4-6-11-23)30(42)12-9-17-50-31-13-7-8-16-36-31/h7-8,13-16,20-23,26-27,30,42H,4-6,9-12,17-19H2,1-3H3,(H,37,43)(H,38,44)/t26-,27-,30-/m0/s1 |
| InChIKey | QYCOZFBEJPLMMS-VWYPKUQYSA-N |
| XLogP | 5.91 |
| TPSA | 204.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.84 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|