About disodium;N-oxonitramide
disodium;N-oxonitramide (PubChem CID 10129945) has the molecular formula N2Na2O3+2
and a molecular weight of 121.99 g/mol. Its IUPAC name is disodium;N-oxonitramide.
Molecular Properties
| Compound Name | disodium;N-oxonitramide |
| PubChem CID | 10129945 |
| Molecular Formula | N2Na2O3+2 |
| Molecular Weight | 121.99 g/mol |
| Exact Mass | 121.97 |
| IUPAC Name | disodium;N-oxonitramide |
| SMILES | O=N[N+](=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/N2O3.2Na/c3-1-2(4)5;;/q;2*+1 |
| InChIKey | XDPWLJKQGUTUKZ-UHFFFAOYSA-N |
| XLogP | -6.05 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.99 |
| LogP ≤ 5 | -6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze disodium;N-oxonitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;N-oxonitramide?
The IUPAC name of disodium;N-oxonitramide (CID 10129945) is disodium;N-oxonitramide.
What is the SMILES notation for disodium;N-oxonitramide?
The canonical SMILES for disodium;N-oxonitramide is O=N[N+](=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;N-oxonitramide?
The InChIKey is XDPWLJKQGUTUKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/N2O3.2Na/c3-1-2(4)5;;/q;2*+1.
What are the key properties of disodium;N-oxonitramide?
disodium;N-oxonitramide has a molecular weight of 121.99 g/mol, XLogP of -6.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;N-oxonitramide is sourced from PubChem (CID 10129945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).