potassium 2-chloro-3,6-dinitrobenzenesulfonate

C6H2ClKN2O7S — CID 101305531

IUPACpotassium 2-chloro-3,6-dinitrobenzenesulfonate
SMILESO=[N+]([O-])c1ccc([N+](=O)[O-])c(S(=O)(=O)[O-])c1Cl.[K+]
InChIInChI=1S/C6H3ClN2O7S.K/c7-5-3(8(10)11)1-2-4(9(12)13)6(5)17(14,15)16;/h1-2H,(H,14,15,16);/q;+1/p-1
InChIKeyBQUNOCUHTUHCAA-UHFFFAOYSA-M
MW320.71 g/mol
LogP-1.94
Rot. Bonds3

About potassium 2-chloro-3,6-dinitrobenzenesulfonate

potassium 2-chloro-3,6-dinitrobenzenesulfonate (PubChem CID 101305531) has the molecular formula C6H2ClKN2O7S and a molecular weight of 320.71 g/mol. Its IUPAC name is potassium 2-chloro-3,6-dinitrobenzenesulfonate.

Molecular Properties

Compound Namepotassium 2-chloro-3,6-dinitrobenzenesulfonate
PubChem CID101305531
Molecular FormulaC6H2ClKN2O7S
Molecular Weight320.71 g/mol
Exact Mass319.89
IUPAC Namepotassium 2-chloro-3,6-dinitrobenzenesulfonate
SMILESO=[N+]([O-])c1ccc([N+](=O)[O-])c(S(=O)(=O)[O-])c1Cl.[K+]
InChIInChI=1S/C6H3ClN2O7S.K/c7-5-3(8(10)11)1-2-4(9(12)13)6(5)17(14,15)16;/h1-2H,(H,14,15,16);/q;+1/p-1
InChIKeyBQUNOCUHTUHCAA-UHFFFAOYSA-M
XLogP-1.94
TPSA143.48 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.71
LogP ≤ 5-1.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze potassium 2-chloro-3,6-dinitrobenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2-chloro-3,6-dinitrobenzenesulfonate?
The IUPAC name of potassium 2-chloro-3,6-dinitrobenzenesulfonate (CID 101305531) is potassium 2-chloro-3,6-dinitrobenzenesulfonate.
What is the SMILES notation for potassium 2-chloro-3,6-dinitrobenzenesulfonate?
The canonical SMILES for potassium 2-chloro-3,6-dinitrobenzenesulfonate is O=[N+]([O-])c1ccc([N+](=O)[O-])c(S(=O)(=O)[O-])c1Cl.[K+].
What is the InChIKey of potassium 2-chloro-3,6-dinitrobenzenesulfonate?
The InChIKey is BQUNOCUHTUHCAA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H3ClN2O7S.K/c7-5-3(8(10)11)1-2-4(9(12)13)6(5)17(14,15)16;/h1-2H,(H,14,15,16);/q;+1/p-1.
What are the key properties of potassium 2-chloro-3,6-dinitrobenzenesulfonate?
potassium 2-chloro-3,6-dinitrobenzenesulfonate has a molecular weight of 320.71 g/mol, XLogP of -1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-chloro-3,6-dinitrobenzenesulfonate is sourced from PubChem (CID 101305531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).