C6H2ClKN2O7S — CID 101305531
potassium 2-chloro-3,6-dinitrobenzenesulfonate (PubChem CID 101305531) has the molecular formula C6H2ClKN2O7S and a molecular weight of 320.71 g/mol. Its IUPAC name is potassium 2-chloro-3,6-dinitrobenzenesulfonate.
| Compound Name | potassium 2-chloro-3,6-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 101305531 |
| Molecular Formula | C6H2ClKN2O7S |
| Molecular Weight | 320.71 g/mol |
| Exact Mass | 319.89 |
| IUPAC Name | potassium 2-chloro-3,6-dinitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc([N+](=O)[O-])c(S(=O)(=O)[O-])c1Cl.[K+] |
| InChI | InChI=1S/C6H3ClN2O7S.K/c7-5-3(8(10)11)1-2-4(9(12)13)6(5)17(14,15)16;/h1-2H,(H,14,15,16);/q;+1/p-1 |
| InChIKey | BQUNOCUHTUHCAA-UHFFFAOYSA-M |
| XLogP | -1.94 |
| TPSA | 143.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.71 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|