C34H53NaO7S — CID 101308275
sodium 2,3-bis[[(E)-tridec-8-enoxy]carbonyl]benzenesulfonate (PubChem CID 101308275) has the molecular formula C34H53NaO7S and a molecular weight of 628.85 g/mol. Its IUPAC name is sodium 2,3-bis[[(E)-tridec-8-enoxy]carbonyl]benzenesulfonate.
| Compound Name | sodium 2,3-bis[[(E)-tridec-8-enoxy]carbonyl]benzenesulfonate |
|---|---|
| PubChem CID | 101308275 |
| Molecular Formula | C34H53NaO7S |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | sodium 2,3-bis[[(E)-tridec-8-enoxy]carbonyl]benzenesulfonate |
| SMILES | CCCC/C=C/CCCCCCCOC(=O)c1cccc(S(=O)(=O)[O-])c1C(=O)OCCCCCCC/C=C/CCCC.[Na+] |
| InChI | InChI=1S/C34H54O7S.Na/c1-3-5-7-9-11-13-15-17-19-21-23-28-40-33(35)30-26-25-27-31(42(37,38)39)32(30)34(36)41-29-24-22-20-18-16-14-12-10-8-6-4-2;/h9-12,25-27H,3-8,13-24,28-29H2,1-2H3,(H,37,38,39);/q;+1/p-1/b11-9+,12-10+; |
| InChIKey | DHQFKNNQEPLANG-NVUWAARKSA-M |
| XLogP | 6.08 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|