C68H106CaO14S2 — CID 101308342
calcium bis(2,3-bis[[(E)-tridec-10-enoxy]carbonyl]benzenesulfonate) (PubChem CID 101308342) has the molecular formula C68H106CaO14S2 and a molecular weight of 1251.79 g/mol. Its IUPAC name is calcium bis(2,3-bis[[(E)-tridec-10-enoxy]carbonyl]benzenesulfonate).
| Compound Name | calcium bis(2,3-bis[[(E)-tridec-10-enoxy]carbonyl]benzenesulfonate) |
|---|---|
| PubChem CID | 101308342 |
| Molecular Formula | C68H106CaO14S2 |
| Molecular Weight | 1251.79 g/mol |
| Exact Mass | 1250.66 |
| IUPAC Name | calcium bis(2,3-bis[[(E)-tridec-10-enoxy]carbonyl]benzenesulfonate) |
| SMILES | CC/C=C/CCCCCCCCCOC(=O)c1cccc(S(=O)(=O)[O-])c1C(=O)OCCCCCCCCC/C=C/CC.CC/C=C/CCCCCCCCCOC(=O)c1cccc(S(=O)(=O)[O-])c1C(=O)OCCCCCCCCC/C=C/CC.[Ca+2] |
| InChI | InChI=1S/2C34H54O7S.Ca/c2*1-3-5-7-9-11-13-15-17-19-21-23-28-40-33(35)30-26-25-27-31(42(37,38)39)32(30)34(36)41-29-24-22-20-18-16-14-12-10-8-6-4-2;/h2*5-8,25-27H,3-4,9-24,28-29H2,1-2H3,(H,37,38,39);/q;;+2/p-2/b2*7-5+,8-6+; |
| InChIKey | XZDONCHVODINDS-XVGSOSPHSA-L |
| XLogP | 17.78 |
| TPSA | 219.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1251.79 |
| LogP ≤ 5 | 17.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|