C25H28O7 — CID 101316859
2,7-dihydroxy-5-(hydroxymethyl)-3-(1-hydroxy-3-methyl-2-methylidenebutyl)-2,8-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one (PubChem CID 101316859) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is 2,7-dihydroxy-5-(hydroxymethyl)-3-(1-hydroxy-3-methyl-2-methylidenebutyl)-2,8-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one.
| Compound Name | 2,7-dihydroxy-5-(hydroxymethyl)-3-(1-hydroxy-3-methyl-2-methylidenebutyl)-2,8-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one |
|---|---|
| PubChem CID | 101316859 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2,7-dihydroxy-5-(hydroxymethyl)-3-(1-hydroxy-3-methyl-2-methylidenebutyl)-2,8-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one |
| SMILES | C=C(C(C)C)C(O)C1Cc2c(cc3oc4ccc(C)c(O)c4c(=O)c3c2CO)OC1(C)O |
| InChI | InChI=1S/C25H28O7/c1-11(2)13(4)23(28)16-8-14-15(10-26)20-19(9-18(14)32-25(16,5)30)31-17-7-6-12(3)22(27)21(17)24(20)29/h6-7,9,11,16,23,26-28,30H,4,8,10H2,1-3,5H3 |
| InChIKey | HNQOJRSEGVBANN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|