C26H28O6 — CID 162982780
9,17-dihydroxy-2,5,7,7,13,18-hexamethyl-8-methylidene-4,6,22-trioxapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,12,16(21),17,19-hexaen-15-one (PubChem CID 162982780) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is 9,17-dihydroxy-2,5,7,7,13,18-hexamethyl-8-methylidene-4,6,22-trioxapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,12,16(21),17,19-hexaen-15-one.
| Compound Name | 9,17-dihydroxy-2,5,7,7,13,18-hexamethyl-8-methylidene-4,6,22-trioxapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,12,16(21),17,19-hexaen-15-one |
|---|---|
| PubChem CID | 162982780 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 9,17-dihydroxy-2,5,7,7,13,18-hexamethyl-8-methylidene-4,6,22-trioxapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,12,16(21),17,19-hexaen-15-one |
| SMILES | C=C1C(O)C2Cc3c(c(C)c4oc5ccc(C)c(O)c5c(=O)c4c3C)OC2(C)OC1(C)C |
| InChI | InChI=1S/C26H28O6/c1-11-8-9-17-19(20(11)27)22(29)18-12(2)15-10-16-21(28)14(4)25(5,6)32-26(16,7)31-23(15)13(3)24(18)30-17/h8-9,16,21,27-28H,4,10H2,1-3,5-7H3 |
| InChIKey | QTBGKLUEEXQABZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|