C30H32O7 — CID 163016983
(13S)-6,8,17,19-tetrahydroxy-14,14-dimethyl-7,18-bis(3-methylbut-2-enyl)-3,15-dioxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(20),2(11),4(9),5,7,16,18-heptaen-10-one (PubChem CID 163016983) has the molecular formula C30H32O7 and a molecular weight of 504.58 g/mol. Its IUPAC name is (13S)-6,8,17,19-tetrahydroxy-14,14-dimethyl-7,18-bis(3-methylbut-2-enyl)-3,15-dioxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(20),2(11),4(9),5,7,16,18-heptaen-10-one.
| Compound Name | (13S)-6,8,17,19-tetrahydroxy-14,14-dimethyl-7,18-bis(3-methylbut-2-enyl)-3,15-dioxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(20),2(11),4(9),5,7,16,18-heptaen-10-one |
|---|---|
| PubChem CID | 163016983 |
| Molecular Formula | C30H32O7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (13S)-6,8,17,19-tetrahydroxy-14,14-dimethyl-7,18-bis(3-methylbut-2-enyl)-3,15-dioxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(20),2(11),4(9),5,7,16,18-heptaen-10-one |
| SMILES | CC(C)=CCc1c(O)c2c3c(c1O)-c1oc4cc(O)c(CC=C(C)C)c(O)c4c(=O)c1C[C@@H]3C(C)(C)O2 |
| InChI | InChI=1S/C30H32O7/c1-13(2)7-9-15-19(31)12-20-22(24(15)32)26(34)17-11-18-21-23(28(17)36-20)25(33)16(10-8-14(3)4)27(35)29(21)37-30(18,5)6/h7-8,12,18,31-33,35H,9-11H2,1-6H3/t18-/m0/s1 |
| InChIKey | SJUWWYNGZUTHAY-SFHVURJKSA-N |
| XLogP | 6.11 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|