C28H34O6 — CID 162904411
(2R,4S)-4,6,8-trihydroxy-2,4,7-tris(3-methylbut-2-enyl)-1,2-dihydroxanthene-3,9-dione (PubChem CID 162904411) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is (2R,4S)-4,6,8-trihydroxy-2,4,7-tris(3-methylbut-2-enyl)-1,2-dihydroxanthene-3,9-dione.
| Compound Name | (2R,4S)-4,6,8-trihydroxy-2,4,7-tris(3-methylbut-2-enyl)-1,2-dihydroxanthene-3,9-dione |
|---|---|
| PubChem CID | 162904411 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (2R,4S)-4,6,8-trihydroxy-2,4,7-tris(3-methylbut-2-enyl)-1,2-dihydroxanthene-3,9-dione |
| SMILES | CC(C)=CCc1c(O)cc2oc3c(c(=O)c2c1O)C[C@@H](CC=C(C)C)C(=O)[C@]3(O)CC=C(C)C |
| InChI | InChI=1S/C28H34O6/c1-15(2)7-9-18-13-20-25(31)23-22(14-21(29)19(24(23)30)10-8-16(3)4)34-27(20)28(33,26(18)32)12-11-17(5)6/h7-8,11,14,18,29-30,33H,9-10,12-13H2,1-6H3/t18-,28-/m1/s1 |
| InChIKey | PGIRGMVKDLNHIX-KWMCUTETSA-N |
| XLogP | 5.35 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|