C25H26O5 — CID 162885344
(1S,2R)-1,11-dihydroxy-5-methyl-10-(3-methylbut-2-enyl)-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one (PubChem CID 162885344) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is (1S,2R)-1,11-dihydroxy-5-methyl-10-(3-methylbut-2-enyl)-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one.
| Compound Name | (1S,2R)-1,11-dihydroxy-5-methyl-10-(3-methylbut-2-enyl)-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one |
|---|---|
| PubChem CID | 162885344 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (1S,2R)-1,11-dihydroxy-5-methyl-10-(3-methylbut-2-enyl)-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one |
| SMILES | C=C(C)[C@@H]1COc2c(C)cc3oc4ccc(CC=C(C)C)c(O)c4c(=O)c3c2[C@H]1O |
| InChI | InChI=1S/C25H26O5/c1-12(2)6-7-15-8-9-17-20(22(15)26)24(28)19-18(30-17)10-14(5)25-21(19)23(27)16(11-29-25)13(3)4/h6,8-10,16,23,26-27H,3,7,11H2,1-2,4-5H3/t16-,23-/m0/s1 |
| InChIKey | UAGOXGIYOPSKFF-HJPURHCSSA-N |
| XLogP | 5.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|