C26H30O8 — CID 156581702
(1R,2S)-8-[(1R,2R)-2,3-dihydroxy-1-methoxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one (PubChem CID 156581702) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is (1R,2S)-8-[(1R,2R)-2,3-dihydroxy-1-methoxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one.
| Compound Name | (1R,2S)-8-[(1R,2R)-2,3-dihydroxy-1-methoxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one |
|---|---|
| PubChem CID | 156581702 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | (1R,2S)-8-[(1R,2R)-2,3-dihydroxy-1-methoxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one |
| SMILES | C=C(C)[C@H]1COc2c(C)cc3oc4c([C@@H](OC)[C@@H](O)C(C)(C)O)ccc(O)c4c(=O)c3c2[C@@H]1O |
| InChI | InChI=1S/C26H30O8/c1-11(2)14-10-33-22-12(3)9-16-18(19(22)20(14)28)21(29)17-15(27)8-7-13(23(17)34-16)24(32-6)25(30)26(4,5)31/h7-9,14,20,24-25,27-28,30-31H,1,10H2,2-6H3/t14-,20-,24-,25-/m1/s1 |
| InChIKey | PPIPJGALHMEMHA-ZELQLRTASA-N |
| XLogP | 3.40 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|