C18H18O8 — CID 26204902
3,8-dihydroxy-1-methoxy-4-[(2R,3R)-1,3,4-trihydroxybutan-2-yl]xanthen-9-one (PubChem CID 26204902) has the molecular formula C18H18O8 and a molecular weight of 362.33 g/mol. Its IUPAC name is 3,8-dihydroxy-1-methoxy-4-[(2R,3R)-1,3,4-trihydroxybutan-2-yl]xanthen-9-one.
| Compound Name | 3,8-dihydroxy-1-methoxy-4-[(2R,3R)-1,3,4-trihydroxybutan-2-yl]xanthen-9-one |
|---|---|
| PubChem CID | 26204902 |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3,8-dihydroxy-1-methoxy-4-[(2R,3R)-1,3,4-trihydroxybutan-2-yl]xanthen-9-one |
| SMILES | COc1cc(O)c([C@H](CO)[C@@H](O)CO)c2oc3cccc(O)c3c(=O)c12 |
| InChI | InChI=1S/C18H18O8/c1-25-13-5-10(22)14(8(6-19)11(23)7-20)18-16(13)17(24)15-9(21)3-2-4-12(15)26-18/h2-5,8,11,19-23H,6-7H2,1H3/t8-,11+/m1/s1 |
| InChIKey | WHNAJPFARNBVDZ-KCJUWKMLSA-N |
| XLogP | 0.80 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|