C27H32O7 — CID 139587653
(1R,2S)-8-[(2S)-2,3-dimethoxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one (PubChem CID 139587653) has the molecular formula C27H32O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is (1R,2S)-8-[(2S)-2,3-dimethoxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one.
| Compound Name | (1R,2S)-8-[(2S)-2,3-dimethoxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one |
|---|---|
| PubChem CID | 139587653 |
| Molecular Formula | C27H32O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (1R,2S)-8-[(2S)-2,3-dimethoxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one |
| SMILES | C=C(C)[C@H]1COc2c(C)cc3oc4c(C[C@H](OC)C(C)(C)OC)ccc(O)c4c(=O)c3c2[C@@H]1O |
| InChI | InChI=1S/C27H32O7/c1-13(2)16-12-33-25-14(3)10-18-21(22(25)23(16)29)24(30)20-17(28)9-8-15(26(20)34-18)11-19(31-6)27(4,5)32-7/h8-10,16,19,23,28-29H,1,11-12H2,2-7H3/t16-,19+,23-/m1/s1 |
| InChIKey | ZYENQXOKBJDPNM-BVZALQNUSA-N |
| XLogP | 4.56 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|