C24H41O2PS2Zn — CID 101318659
zinc [2,4-di(nonyl)phenyl]sulfanyl-dioxido-sulfanylidene-λ5-phosphane (PubChem CID 101318659) has the molecular formula C24H41O2PS2Zn and a molecular weight of 522.09 g/mol. Its IUPAC name is zinc [2,4-di(nonyl)phenyl]sulfanyl-dioxido-sulfanylidene-λ5-phosphane.
| Compound Name | zinc [2,4-di(nonyl)phenyl]sulfanyl-dioxido-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 101318659 |
| Molecular Formula | C24H41O2PS2Zn |
| Molecular Weight | 522.09 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | zinc [2,4-di(nonyl)phenyl]sulfanyl-dioxido-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCCCCc1ccc(SP([O-])([O-])=S)c(CCCCCCCCC)c1.[Zn+2] |
| InChI | InChI=1S/C24H43O2PS2.Zn/c1-3-5-7-9-11-13-15-17-22-19-20-24(29-27(25,26)28)23(21-22)18-16-14-12-10-8-6-4-2;/h19-21H,3-18H2,1-2H3,(H2,25,26,28);/q;+2/p-2 |
| InChIKey | MOAUVGGDKZFRPJ-UHFFFAOYSA-L |
| XLogP | 7.31 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.09 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|