C32H50MoO4P2S4 — CID 87488768
bis((2,3-dipentylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane);molybdenum(4+) (PubChem CID 87488768) has the molecular formula C32H50MoO4P2S4 and a molecular weight of 784.90 g/mol. Its IUPAC name is bis((2,3-dipentylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane);molybdenum(4+).
| Compound Name | bis((2,3-dipentylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane);molybdenum(4+) |
|---|---|
| PubChem CID | 87488768 |
| Molecular Formula | C32H50MoO4P2S4 |
| Molecular Weight | 784.90 g/mol |
| Exact Mass | 786.11 |
| IUPAC Name | bis((2,3-dipentylphenyl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane);molybdenum(4+) |
| SMILES | CCCCCc1cccc(SP([O-])([O-])=S)c1CCCCC.CCCCCc1cccc(SP([O-])([O-])=S)c1CCCCC.[Mo+4] |
| InChI | InChI=1S/2C16H27O2PS2.Mo/c2*1-3-5-7-10-14-11-9-13-16(21-19(17,18)20)15(14)12-8-6-4-2;/h2*9,11,13H,3-8,10,12H2,1-2H3,(H2,17,18,20);/q;;+4/p-4 |
| InChIKey | LRVBWENGEGFJEI-UHFFFAOYSA-J |
| XLogP | 8.38 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.90 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|