C21H35MoNS2 — CID 87835431
(2,3-diheptylphenyl) carbamodithioate;molybdenum (PubChem CID 87835431) has the molecular formula C21H35MoNS2 and a molecular weight of 461.59 g/mol. Its IUPAC name is (2,3-diheptylphenyl) carbamodithioate;molybdenum.
| Compound Name | (2,3-diheptylphenyl) carbamodithioate;molybdenum |
|---|---|
| PubChem CID | 87835431 |
| Molecular Formula | C21H35MoNS2 |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | (2,3-diheptylphenyl) carbamodithioate;molybdenum |
| SMILES | CCCCCCCc1cccc(SC(N)=S)c1CCCCCCC.[Mo] |
| InChI | InChI=1S/C21H35NS2.Mo/c1-3-5-7-9-11-14-18-15-13-17-20(24-21(22)23)19(18)16-12-10-8-6-4-2;/h13,15,17H,3-12,14,16H2,1-2H3,(H2,22,23); |
| InChIKey | IXVCKOWSCJXJPY-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|