About (2-butylphenyl) carbamodithioate;molybdenum
(2-butylphenyl) carbamodithioate;molybdenum (PubChem CID 159051812) has the molecular formula C11H15MoNS2
and a molecular weight of 321.32 g/mol. Its IUPAC name is (2-butylphenyl) carbamodithioate;molybdenum.
Molecular Properties
| Compound Name | (2-butylphenyl) carbamodithioate;molybdenum |
| PubChem CID | 159051812 |
| Molecular Formula | C11H15MoNS2 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | (2-butylphenyl) carbamodithioate;molybdenum |
| SMILES | CCCCc1ccccc1SC(N)=S.[Mo] |
| InChI | InChI=1S/C11H15NS2.Mo/c1-2-3-6-9-7-4-5-8-10(9)14-11(12)13;/h4-5,7-8H,2-3,6H2,1H3,(H2,12,13); |
| InChIKey | JXIXYCIPIYXJBP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-butylphenyl) carbamodithioate;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butylphenyl) carbamodithioate;molybdenum?
The IUPAC name of (2-butylphenyl) carbamodithioate;molybdenum (CID 159051812) is (2-butylphenyl) carbamodithioate;molybdenum.
What is the SMILES notation for (2-butylphenyl) carbamodithioate;molybdenum?
The canonical SMILES for (2-butylphenyl) carbamodithioate;molybdenum is CCCCc1ccccc1SC(N)=S.[Mo].
What is the InChIKey of (2-butylphenyl) carbamodithioate;molybdenum?
The InChIKey is JXIXYCIPIYXJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS2.Mo/c1-2-3-6-9-7-4-5-8-10(9)14-11(12)13;/h4-5,7-8H,2-3,6H2,1H3,(H2,12,13);.
What are the key properties of (2-butylphenyl) carbamodithioate;molybdenum?
(2-butylphenyl) carbamodithioate;molybdenum has a molecular weight of 321.32 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butylphenyl) carbamodithioate;molybdenum is sourced from PubChem (CID 159051812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).