About methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid
methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid (PubChem CID 174984210) has the molecular formula C14H20O4S
and a molecular weight of 284.38 g/mol. Its IUPAC name is methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid.
Molecular Properties
| Compound Name | methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid |
| PubChem CID | 174984210 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid |
| SMILES | CCCCCc1ccccc1SC(=O)C(=O)O.CO |
| InChI | InChI=1S/C13H16O3S.CH4O/c1-2-3-4-7-10-8-5-6-9-11(10)17-13(16)12(14)15;1-2/h5-6,8-9H,2-4,7H2,1H3,(H,14,15);2H,1H3 |
| InChIKey | DIAKVKGRLFUTOX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid?
The IUPAC name of methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid (CID 174984210) is methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid.
What is the SMILES notation for methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid?
The canonical SMILES for methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid is CCCCCc1ccccc1SC(=O)C(=O)O.CO.
What is the InChIKey of methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid?
The InChIKey is DIAKVKGRLFUTOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3S.CH4O/c1-2-3-4-7-10-8-5-6-9-11(10)17-13(16)12(14)15;1-2/h5-6,8-9H,2-4,7H2,1H3,(H,14,15);2H,1H3.
What are the key properties of methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid?
methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid has a molecular weight of 284.38 g/mol, XLogP of 2.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-oxo-2-(2-pentylphenyl)sulfanylacetic acid is sourced from PubChem (CID 174984210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).