C33H42N2S4 — CID 140862881
(2-hexylphenyl) N-[[(2-hexylphenyl)sulfanylcarbothioylamino]-phenylmethyl]carbamodithioate (PubChem CID 140862881) has the molecular formula C33H42N2S4 and a molecular weight of 594.98 g/mol. Its IUPAC name is (2-hexylphenyl) N-[[(2-hexylphenyl)sulfanylcarbothioylamino]-phenylmethyl]carbamodithioate.
| Compound Name | (2-hexylphenyl) N-[[(2-hexylphenyl)sulfanylcarbothioylamino]-phenylmethyl]carbamodithioate |
|---|---|
| PubChem CID | 140862881 |
| Molecular Formula | C33H42N2S4 |
| Molecular Weight | 594.98 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | (2-hexylphenyl) N-[[(2-hexylphenyl)sulfanylcarbothioylamino]-phenylmethyl]carbamodithioate |
| SMILES | CCCCCCc1ccccc1SC(=S)NC(NC(=S)Sc1ccccc1CCCCCC)c1ccccc1 |
| InChI | InChI=1S/C33H42N2S4/c1-3-5-7-10-18-26-20-14-16-24-29(26)38-32(36)34-31(28-22-12-9-13-23-28)35-33(37)39-30-25-17-15-21-27(30)19-11-8-6-4-2/h9,12-17,20-25,31H,3-8,10-11,18-19H2,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | RKJZRDCXNSCFSL-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.98 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|