About (2-ethylphenyl) N-hexylcarbamodithioate
(2-ethylphenyl) N-hexylcarbamodithioate (PubChem CID 141442506) has the molecular formula C15H23NS2
and a molecular weight of 281.49 g/mol. Its IUPAC name is (2-ethylphenyl) N-hexylcarbamodithioate.
Molecular Properties
| Compound Name | (2-ethylphenyl) N-hexylcarbamodithioate |
| PubChem CID | 141442506 |
| Molecular Formula | C15H23NS2 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (2-ethylphenyl) N-hexylcarbamodithioate |
| SMILES | CCCCCCNC(=S)Sc1ccccc1CC |
| InChI | InChI=1S/C15H23NS2/c1-3-5-6-9-12-16-15(17)18-14-11-8-7-10-13(14)4-2/h7-8,10-11H,3-6,9,12H2,1-2H3,(H,16,17) |
| InChIKey | VTLYLJPXSXLXQS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-ethylphenyl) N-hexylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylphenyl) N-hexylcarbamodithioate?
The IUPAC name of (2-ethylphenyl) N-hexylcarbamodithioate (CID 141442506) is (2-ethylphenyl) N-hexylcarbamodithioate.
What is the SMILES notation for (2-ethylphenyl) N-hexylcarbamodithioate?
The canonical SMILES for (2-ethylphenyl) N-hexylcarbamodithioate is CCCCCCNC(=S)Sc1ccccc1CC.
What is the InChIKey of (2-ethylphenyl) N-hexylcarbamodithioate?
The InChIKey is VTLYLJPXSXLXQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NS2/c1-3-5-6-9-12-16-15(17)18-14-11-8-7-10-13(14)4-2/h7-8,10-11H,3-6,9,12H2,1-2H3,(H,16,17).
What are the key properties of (2-ethylphenyl) N-hexylcarbamodithioate?
(2-ethylphenyl) N-hexylcarbamodithioate has a molecular weight of 281.49 g/mol, XLogP of 4.80, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylphenyl) N-hexylcarbamodithioate is sourced from PubChem (CID 141442506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).