C23H39NO2S2 — CID 87984769
[(2,3-dioctylphenyl)disulfanyl]carbamic acid (PubChem CID 87984769) has the molecular formula C23H39NO2S2 and a molecular weight of 425.70 g/mol. Its IUPAC name is [(2,3-dioctylphenyl)disulfanyl]carbamic acid.
| Compound Name | [(2,3-dioctylphenyl)disulfanyl]carbamic acid |
|---|---|
| PubChem CID | 87984769 |
| Molecular Formula | C23H39NO2S2 |
| Molecular Weight | 425.70 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | [(2,3-dioctylphenyl)disulfanyl]carbamic acid |
| SMILES | CCCCCCCCc1cccc(SSNC(=O)O)c1CCCCCCCC |
| InChI | InChI=1S/C23H39NO2S2/c1-3-5-7-9-11-13-16-20-17-15-19-22(27-28-24-23(25)26)21(20)18-14-12-10-8-6-4-2/h15,17,19,24H,3-14,16,18H2,1-2H3,(H,25,26) |
| InChIKey | AIIXFOYJHPTTCR-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.70 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|