C38H60N2O4S4Zn — CID 87878467
zinc bis(N-[(2,3-dihexylphenyl)disulfanyl]carbamate) (PubChem CID 87878467) has the molecular formula C38H60N2O4S4Zn and a molecular weight of 802.57 g/mol. Its IUPAC name is zinc bis(N-[(2,3-dihexylphenyl)disulfanyl]carbamate).
| Compound Name | zinc bis(N-[(2,3-dihexylphenyl)disulfanyl]carbamate) |
|---|---|
| PubChem CID | 87878467 |
| Molecular Formula | C38H60N2O4S4Zn |
| Molecular Weight | 802.57 g/mol |
| Exact Mass | 800.27 |
| IUPAC Name | zinc bis(N-[(2,3-dihexylphenyl)disulfanyl]carbamate) |
| SMILES | CCCCCCc1cccc(SSNC(=O)[O-])c1CCCCCC.CCCCCCc1cccc(SSNC(=O)[O-])c1CCCCCC.[Zn+2] |
| InChI | InChI=1S/2C19H31NO2S2.Zn/c2*1-3-5-7-9-12-16-13-11-15-18(23-24-20-19(21)22)17(16)14-10-8-6-4-2;/h2*11,13,15,20H,3-10,12,14H2,1-2H3,(H,21,22);/q;;+2/p-2 |
| InChIKey | QAJKSPXWUCPIDG-UHFFFAOYSA-L |
| XLogP | 11.04 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.57 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|