C15H25NO5 — CID 101326347
1-[(5-butyl-2-hydroxyphenyl)methyl-(1,1-dihydroxyethyl)amino]ethane-1,1-diol (PubChem CID 101326347) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[(5-butyl-2-hydroxyphenyl)methyl-(1,1-dihydroxyethyl)amino]ethane-1,1-diol.
| Compound Name | 1-[(5-butyl-2-hydroxyphenyl)methyl-(1,1-dihydroxyethyl)amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 101326347 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-[(5-butyl-2-hydroxyphenyl)methyl-(1,1-dihydroxyethyl)amino]ethane-1,1-diol |
| SMILES | CCCCc1ccc(O)c(CN(C(C)(O)O)C(C)(O)O)c1 |
| InChI | InChI=1S/C15H25NO5/c1-4-5-6-11-7-8-13(17)12(9-11)10-16(14(2,18)19)15(3,20)21/h7-9,17-21H,4-6,10H2,1-3H3 |
| InChIKey | POHLGRUYYKSANZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|