C16H27NO5 — CID 101326356
1-[1,1-dihydroxyethyl-[(5-hydroxy-2-pentylphenyl)methyl]amino]ethane-1,1-diol (PubChem CID 101326356) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-[1,1-dihydroxyethyl-[(5-hydroxy-2-pentylphenyl)methyl]amino]ethane-1,1-diol.
| Compound Name | 1-[1,1-dihydroxyethyl-[(5-hydroxy-2-pentylphenyl)methyl]amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 101326356 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-[1,1-dihydroxyethyl-[(5-hydroxy-2-pentylphenyl)methyl]amino]ethane-1,1-diol |
| SMILES | CCCCCc1ccc(O)cc1CN(C(C)(O)O)C(C)(O)O |
| InChI | InChI=1S/C16H27NO5/c1-4-5-6-7-12-8-9-14(18)10-13(12)11-17(15(2,19)20)16(3,21)22/h8-10,18-22H,4-7,11H2,1-3H3 |
| InChIKey | RRGNKQPLOWSTIA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|