C34H46O2 — CID 19356842
4-[2-[3-[2-(4-hydroxy-2-pentylphenyl)propan-2-yl]phenyl]propan-2-yl]-3-pentylphenol (PubChem CID 19356842) has the molecular formula C34H46O2 and a molecular weight of 486.74 g/mol. Its IUPAC name is 4-[2-[3-[2-(4-hydroxy-2-pentylphenyl)propan-2-yl]phenyl]propan-2-yl]-3-pentylphenol.
| Compound Name | 4-[2-[3-[2-(4-hydroxy-2-pentylphenyl)propan-2-yl]phenyl]propan-2-yl]-3-pentylphenol |
|---|---|
| PubChem CID | 19356842 |
| Molecular Formula | C34H46O2 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | 4-[2-[3-[2-(4-hydroxy-2-pentylphenyl)propan-2-yl]phenyl]propan-2-yl]-3-pentylphenol |
| SMILES | CCCCCc1cc(O)ccc1C(C)(C)c1cccc(C(C)(C)c2ccc(O)cc2CCCCC)c1 |
| InChI | InChI=1S/C34H46O2/c1-7-9-11-14-25-22-29(35)18-20-31(25)33(3,4)27-16-13-17-28(24-27)34(5,6)32-21-19-30(36)23-26(32)15-12-10-8-2/h13,16-24,35-36H,7-12,14-15H2,1-6H3 |
| InChIKey | NHMDUEZJXZPDLL-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|