C27H40 — CID 101326735
1,4-ditert-butyl-2-[3-(4-tert-butylphenyl)propyl]benzene (PubChem CID 101326735) has the molecular formula C27H40 and a molecular weight of 364.62 g/mol. Its IUPAC name is 1,4-ditert-butyl-2-[3-(4-tert-butylphenyl)propyl]benzene.
| Compound Name | 1,4-ditert-butyl-2-[3-(4-tert-butylphenyl)propyl]benzene |
|---|---|
| PubChem CID | 101326735 |
| Molecular Formula | C27H40 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | 1,4-ditert-butyl-2-[3-(4-tert-butylphenyl)propyl]benzene |
| SMILES | CC(C)(C)c1ccc(CCCc2cc(C(C)(C)C)ccc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H40/c1-25(2,3)22-15-13-20(14-16-22)11-10-12-21-19-23(26(4,5)6)17-18-24(21)27(7,8)9/h13-19H,10-12H2,1-9H3 |
| InChIKey | YTGLTFOOTKFOIS-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |