C19H19Cl2N3O4 — CID 101326927
N-chloro-2-[(3-chloro-4-methylphenyl)diazenyl]-N-(2,5-dimethoxyphenyl)-3-oxobutanamide (PubChem CID 101326927) has the molecular formula C19H19Cl2N3O4 and a molecular weight of 424.28 g/mol. Its IUPAC name is N-chloro-2-[(3-chloro-4-methylphenyl)diazenyl]-N-(2,5-dimethoxyphenyl)-3-oxobutanamide.
| Compound Name | N-chloro-2-[(3-chloro-4-methylphenyl)diazenyl]-N-(2,5-dimethoxyphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 101326927 |
| Molecular Formula | C19H19Cl2N3O4 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-chloro-2-[(3-chloro-4-methylphenyl)diazenyl]-N-(2,5-dimethoxyphenyl)-3-oxobutanamide |
| SMILES | COc1ccc(OC)c(N(Cl)C(=O)C(/N=N/c2ccc(C)c(Cl)c2)C(C)=O)c1 |
| InChI | InChI=1S/C19H19Cl2N3O4/c1-11-5-6-13(9-15(11)20)22-23-18(12(2)25)19(26)24(21)16-10-14(27-3)7-8-17(16)28-4/h5-10,18H,1-4H3/b23-22+ |
| InChIKey | ZLUWJRQENMHAAU-GHVJWSGMSA-N |
| XLogP | 4.89 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|