C18H28O5Si — CID 101334653
dimethyl (3aR,4S,6aS)-5-oxo-6-propan-2-ylidene-4-trimethylsilyl-3,3a,4,6a-tetrahydro-1H-pentalene-2,2-dicarboxylate (PubChem CID 101334653) has the molecular formula C18H28O5Si and a molecular weight of 352.50 g/mol. Its IUPAC name is dimethyl (3aR,4S,6aS)-5-oxo-6-propan-2-ylidene-4-trimethylsilyl-3,3a,4,6a-tetrahydro-1H-pentalene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,4S,6aS)-5-oxo-6-propan-2-ylidene-4-trimethylsilyl-3,3a,4,6a-tetrahydro-1H-pentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101334653 |
| Molecular Formula | C18H28O5Si |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | dimethyl (3aR,4S,6aS)-5-oxo-6-propan-2-ylidene-4-trimethylsilyl-3,3a,4,6a-tetrahydro-1H-pentalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]2[C@H](C1)C(=C(C)C)C(=O)[C@H]2[Si](C)(C)C |
| InChI | InChI=1S/C18H28O5Si/c1-10(2)13-11-8-18(16(20)22-3,17(21)23-4)9-12(11)15(14(13)19)24(5,6)7/h11-12,15H,8-9H2,1-7H3/t11-,12+,15-/m0/s1 |
| InChIKey | TYXLAKUXVMFURB-ZOWXZIJZSA-N |
| XLogP | 2.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|