C24H42O7Si2 — CID 102112822
dimethyl (3aR,4S,8aS)-8-methylidene-4-triethoxysilyl-6-trimethylsilyl-1,3,3a,4,7,8a-hexahydroazulene-2,2-dicarboxylate (PubChem CID 102112822) has the molecular formula C24H42O7Si2 and a molecular weight of 498.77 g/mol. Its IUPAC name is dimethyl (3aR,4S,8aS)-8-methylidene-4-triethoxysilyl-6-trimethylsilyl-1,3,3a,4,7,8a-hexahydroazulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,4S,8aS)-8-methylidene-4-triethoxysilyl-6-trimethylsilyl-1,3,3a,4,7,8a-hexahydroazulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102112822 |
| Molecular Formula | C24H42O7Si2 |
| Molecular Weight | 498.77 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | dimethyl (3aR,4S,8aS)-8-methylidene-4-triethoxysilyl-6-trimethylsilyl-1,3,3a,4,7,8a-hexahydroazulene-2,2-dicarboxylate |
| SMILES | C=C1CC([Si](C)(C)C)=C[C@@H]([Si](OCC)(OCC)OCC)[C@@H]2CC(C(=O)OC)(C(=O)OC)C[C@H]12 |
| InChI | InChI=1S/C24H42O7Si2/c1-10-29-33(30-11-2,31-12-3)21-14-18(32(7,8)9)13-17(4)19-15-24(16-20(19)21,22(25)27-5)23(26)28-6/h14,19-21H,4,10-13,15-16H2,1-3,5-9H3/t19-,20-,21-/m1/s1 |
| InChIKey | MXFOXWVYMFSUDQ-NJDAHSKKSA-N |
| XLogP | 4.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.77 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|