C15H18O5 — CID 101334974
(5-hydroxy-4,4-dimethylpent-2-ynyl) (4-methoxyphenyl) carbonate (PubChem CID 101334974) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (5-hydroxy-4,4-dimethylpent-2-ynyl) (4-methoxyphenyl) carbonate.
| Compound Name | (5-hydroxy-4,4-dimethylpent-2-ynyl) (4-methoxyphenyl) carbonate |
|---|---|
| PubChem CID | 101334974 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (5-hydroxy-4,4-dimethylpent-2-ynyl) (4-methoxyphenyl) carbonate |
| SMILES | COc1ccc(OC(=O)OCC#CC(C)(C)CO)cc1 |
| InChI | InChI=1S/C15H18O5/c1-15(2,11-16)9-4-10-19-14(17)20-13-7-5-12(18-3)6-8-13/h5-8,16H,10-11H2,1-3H3 |
| InChIKey | ASNATVHPKUGXKM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|