C17H23NO5 — CID 68586745
ethyl N-(4-methoxyphenoxy)carbonyl-4,4-dimethyl-3-oxopentanimidate (PubChem CID 68586745) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is ethyl N-(4-methoxyphenoxy)carbonyl-4,4-dimethyl-3-oxopentanimidate.
| Compound Name | ethyl N-(4-methoxyphenoxy)carbonyl-4,4-dimethyl-3-oxopentanimidate |
|---|---|
| PubChem CID | 68586745 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | ethyl N-(4-methoxyphenoxy)carbonyl-4,4-dimethyl-3-oxopentanimidate |
| SMILES | CCOC(CC(=O)C(C)(C)C)=NC(=O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H23NO5/c1-6-22-15(11-14(19)17(2,3)4)18-16(20)23-13-9-7-12(21-5)8-10-13/h7-10H,6,11H2,1-5H3 |
| InChIKey | IEYTVUONAKROLC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|