C20H23NO4 — CID 68587258
ethyl 4,4-dimethyl-N-naphthalen-2-yloxycarbonyl-3-oxopentanimidate (PubChem CID 68587258) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl 4,4-dimethyl-N-naphthalen-2-yloxycarbonyl-3-oxopentanimidate.
| Compound Name | ethyl 4,4-dimethyl-N-naphthalen-2-yloxycarbonyl-3-oxopentanimidate |
|---|---|
| PubChem CID | 68587258 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | ethyl 4,4-dimethyl-N-naphthalen-2-yloxycarbonyl-3-oxopentanimidate |
| SMILES | CCOC(CC(=O)C(C)(C)C)=NC(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H23NO4/c1-5-24-18(13-17(22)20(2,3)4)21-19(23)25-16-11-10-14-8-6-7-9-15(14)12-16/h6-12H,5,13H2,1-4H3 |
| InChIKey | YAYPKRMXGVGZES-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|