C15H31N3O7 — CID 101335572
N,N,N',N'-tetrakis(2-hydroxyethyl)-2-(3-hydroxypropylamino)butanediamide (PubChem CID 101335572) has the molecular formula C15H31N3O7 and a molecular weight of 365.43 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(2-hydroxyethyl)-2-(3-hydroxypropylamino)butanediamide.
| Compound Name | N,N,N',N'-tetrakis(2-hydroxyethyl)-2-(3-hydroxypropylamino)butanediamide |
|---|---|
| PubChem CID | 101335572 |
| Molecular Formula | C15H31N3O7 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N,N,N',N'-tetrakis(2-hydroxyethyl)-2-(3-hydroxypropylamino)butanediamide |
| SMILES | O=C(CC(NCCCO)C(=O)N(CCO)CCO)N(CCO)CCO |
| InChI | InChI=1S/C15H31N3O7/c19-7-1-2-16-13(15(25)18(5-10-22)6-11-23)12-14(24)17(3-8-20)4-9-21/h13,16,19-23H,1-12H2 |
| InChIKey | VAPYTCYULLQKDY-UHFFFAOYSA-N |
| XLogP | -3.66 |
| TPSA | 153.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|