C14H19NO3S — CID 101336007
(1S,2S)-1-(4-methylphenyl)sulfonyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol (PubChem CID 101336007) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (1S,2S)-1-(4-methylphenyl)sulfonyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol.
| Compound Name | (1S,2S)-1-(4-methylphenyl)sulfonyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol |
|---|---|
| PubChem CID | 101336007 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (1S,2S)-1-(4-methylphenyl)sulfonyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2C3CCCN3C[C@@H]2O)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-10-4-6-11(7-5-10)19(17,18)14-12-3-2-8-15(12)9-13(14)16/h4-7,12-14,16H,2-3,8-9H2,1H3/t12?,13-,14-/m0/s1 |
| InChIKey | QIGMHCDREZFGMA-TTZKSVMKSA-N |
| XLogP | 0.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |