C12H15F3O5SSe — CID 101337018
[2-[(1S)-1-(methoxymethoxy)propyl]phenyl]selanyl trifluoromethanesulfonate (PubChem CID 101337018) has the molecular formula C12H15F3O5SSe and a molecular weight of 407.27 g/mol. Its IUPAC name is [2-[(1S)-1-(methoxymethoxy)propyl]phenyl]selanyl trifluoromethanesulfonate.
| Compound Name | [2-[(1S)-1-(methoxymethoxy)propyl]phenyl]selanyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101337018 |
| Molecular Formula | C12H15F3O5SSe |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | [2-[(1S)-1-(methoxymethoxy)propyl]phenyl]selanyl trifluoromethanesulfonate |
| SMILES | CC[C@H](OCOC)c1ccccc1[Se]OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O5SSe/c1-3-10(19-8-18-2)9-6-4-5-7-11(9)22-20-21(16,17)12(13,14)15/h4-7,10H,3,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | BXJIBEGORZCCMM-JTQLQIEISA-N |
| XLogP | 1.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|