C19H15Cl2NO3 — CID 10134094
3-acetyl-1-benzyl-2-(2,4-dichlorophenyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 10134094) has the molecular formula C19H15Cl2NO3 and a molecular weight of 376.24 g/mol. Its IUPAC name is 3-acetyl-1-benzyl-2-(2,4-dichlorophenyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 3-acetyl-1-benzyl-2-(2,4-dichlorophenyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 10134094 |
| Molecular Formula | C19H15Cl2NO3 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 3-acetyl-1-benzyl-2-(2,4-dichlorophenyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(=O)N(Cc2ccccc2)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl2NO3/c1-11(23)16-17(14-8-7-13(20)9-15(14)21)22(19(25)18(16)24)10-12-5-3-2-4-6-12/h2-9,17,24H,10H2,1H3 |
| InChIKey | FFRMTOJUEMXDCY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |