C25H30O3 — CID 10134274
2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]phenyl]acetic acid (PubChem CID 10134274) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 10134274 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-[4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethynyl]phenyl]acetic acid |
| SMILES | COc1c(C(C)(C)C)cc(C#Cc2ccc(CC(=O)O)cc2)cc1C(C)(C)C |
| InChI | InChI=1S/C25H30O3/c1-24(2,3)20-14-19(15-21(23(20)28-7)25(4,5)6)13-10-17-8-11-18(12-9-17)16-22(26)27/h8-9,11-12,14-15H,16H2,1-7H3,(H,26,27) |
| InChIKey | ZGWVVSCCYFKFBE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|