C81H91N3 — CID 101345246
N-[4-[tris(4-tert-butylphenyl)methyl]phenyl]-1-[6-[[4-[tris(4-tert-butylphenyl)methyl]phenyl]iminomethyl]-2-pyridinyl]methanimine (PubChem CID 101345246) has the molecular formula C81H91N3 and a molecular weight of 1106.64 g/mol. Its IUPAC name is N-[4-[tris(4-tert-butylphenyl)methyl]phenyl]-1-[6-[[4-[tris(4-tert-butylphenyl)methyl]phenyl]iminomethyl]-2-pyridinyl]methanimine.
| Compound Name | N-[4-[tris(4-tert-butylphenyl)methyl]phenyl]-1-[6-[[4-[tris(4-tert-butylphenyl)methyl]phenyl]iminomethyl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 101345246 |
| Molecular Formula | C81H91N3 |
| Molecular Weight | 1106.64 g/mol |
| Exact Mass | 1105.72 |
| IUPAC Name | N-[4-[tris(4-tert-butylphenyl)methyl]phenyl]-1-[6-[[4-[tris(4-tert-butylphenyl)methyl]phenyl]iminomethyl]-2-pyridinyl]methanimine |
| SMILES | CC(C)(C)c1ccc(C(c2ccc(/N=C/c3cccc(/C=N/c4ccc(C(c5ccc(C(C)(C)C)cc5)(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)cc4)n3)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C81H91N3/c1-74(2,3)56-22-34-62(35-23-56)80(63-36-24-57(25-37-63)75(4,5)6,64-38-26-58(27-39-64)76(7,8)9)68-46-50-70(51-47-68)82-54-72-20-19-21-73(84-72)55-83-71-52-48-69(49-53-71)81(65-40-28-59(29-41-65)77(10,11)12,66-42-30-60(31-43-66)78(13,14)15)67-44-32-61(33-45-67)79(16,17)18/h19-55H,1-18H3/b82-54+,83-55+ |
| InChIKey | HZHFUEJJONSZOA-BUSPMDSRSA-N |
| XLogP | 21.13 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1106.64 |
| LogP ≤ 5 | 21.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|