C21H39N2O2+ — CID 101345887
azanium (Z)-7-[(1R,4S,5S,6R)-6-[(E)-oct-1-enyl]-2-azabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid (PubChem CID 101345887) has the molecular formula C21H39N2O2+ and a molecular weight of 351.56 g/mol. Its IUPAC name is azanium (Z)-7-[(1R,4S,5S,6R)-6-[(E)-oct-1-enyl]-2-azabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid.
| Compound Name | azanium (Z)-7-[(1R,4S,5S,6R)-6-[(E)-oct-1-enyl]-2-azabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 101345887 |
| Molecular Formula | C21H39N2O2+ |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.30 |
| IUPAC Name | azanium (Z)-7-[(1R,4S,5S,6R)-6-[(E)-oct-1-enyl]-2-azabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
| SMILES | CCCCCC/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CN[C@@H]1C2.[NH4+] |
| InChI | InChI=1S/C21H35NO2.H3N/c1-2-3-4-5-6-10-13-19-18(17-15-20(19)22-16-17)12-9-7-8-11-14-21(23)24;/h7,9-10,13,17-20,22H,2-6,8,11-12,14-16H2,1H3,(H,23,24);1H3/p+1/b9-7-,13-10+;/t17-,18+,19-,20-;/m1./s1 |
| InChIKey | YFCFNAQQFZDZNV-COMFFUOKSA-O |
| XLogP | 5.31 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|