C25H36O3 — CID 101348148
(4E,8E)-10-[(3S,3aS,4R,5S,6aR)-4-but-2-ynyl-3,5-dimethyl-6-oxo-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-5-yl]-4,8-dimethyldeca-4,8-dienal (PubChem CID 101348148) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is (4E,8E)-10-[(3S,3aS,4R,5S,6aR)-4-but-2-ynyl-3,5-dimethyl-6-oxo-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-5-yl]-4,8-dimethyldeca-4,8-dienal.
| Compound Name | (4E,8E)-10-[(3S,3aS,4R,5S,6aR)-4-but-2-ynyl-3,5-dimethyl-6-oxo-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-5-yl]-4,8-dimethyldeca-4,8-dienal |
|---|---|
| PubChem CID | 101348148 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (4E,8E)-10-[(3S,3aS,4R,5S,6aR)-4-but-2-ynyl-3,5-dimethyl-6-oxo-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-5-yl]-4,8-dimethyldeca-4,8-dienal |
| SMILES | CC#CC[C@@H]1[C@H]2[C@H](C)CO[C@H]2C(=O)[C@@]1(C)C/C=C(\C)CC/C=C(\C)CCC=O |
| InChI | InChI=1S/C25H36O3/c1-6-7-13-21-22-20(4)17-28-23(22)24(27)25(21,5)15-14-19(3)11-8-10-18(2)12-9-16-26/h10,14,16,20-23H,8-9,11-13,15,17H2,1-5H3/b18-10+,19-14+/t20-,21-,22-,23-,25+/m1/s1 |
| InChIKey | BNDGDDZTBJISQA-ZVEOPOQQSA-N |
| XLogP | 5.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|