C27H40O2 — CID 101348143
(3S,3aS,4R,6aR)-4-but-2-ynyl-3-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,3,3a,4,5,6a-hexahydrocyclopenta[b]furan-6-one (PubChem CID 101348143) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is (3S,3aS,4R,6aR)-4-but-2-ynyl-3-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,3,3a,4,5,6a-hexahydrocyclopenta[b]furan-6-one.
| Compound Name | (3S,3aS,4R,6aR)-4-but-2-ynyl-3-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,3,3a,4,5,6a-hexahydrocyclopenta[b]furan-6-one |
|---|---|
| PubChem CID | 101348143 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | (3S,3aS,4R,6aR)-4-but-2-ynyl-3-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,3,3a,4,5,6a-hexahydrocyclopenta[b]furan-6-one |
| SMILES | CC#CC[C@H]1C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)[C@@H]2OC[C@@H](C)[C@@H]21 |
| InChI | InChI=1S/C27H40O2/c1-7-8-15-23-24(26(28)27-25(23)22(6)18-29-27)17-16-21(5)14-10-13-20(4)12-9-11-19(2)3/h11,13,16,22-25,27H,9-10,12,14-15,17-18H2,1-6H3/b20-13+,21-16+/t22-,23+,24?,25-,27-/m1/s1 |
| InChIKey | VPJXODYPSFEHQI-JYXAWQCKSA-N |
| XLogP | 6.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|