C19H26O9 — CID 101348355
diethyl 2-methyl-2-[(2R,5S)-5-(2,2,5-trimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2,5-dihydrofuran-2-yl]propanedioate (PubChem CID 101348355) has the molecular formula C19H26O9 and a molecular weight of 398.41 g/mol. Its IUPAC name is diethyl 2-methyl-2-[(2R,5S)-5-(2,2,5-trimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2,5-dihydrofuran-2-yl]propanedioate.
| Compound Name | diethyl 2-methyl-2-[(2R,5S)-5-(2,2,5-trimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2,5-dihydrofuran-2-yl]propanedioate |
|---|---|
| PubChem CID | 101348355 |
| Molecular Formula | C19H26O9 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | diethyl 2-methyl-2-[(2R,5S)-5-(2,2,5-trimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2,5-dihydrofuran-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)[C@H]1C=C[C@@H](C2(C)C(=O)OC(C)(C)OC2=O)O1 |
| InChI | InChI=1S/C19H26O9/c1-7-24-13(20)18(5,14(21)25-8-2)11-9-10-12(26-11)19(6)15(22)27-17(3,4)28-16(19)23/h9-12H,7-8H2,1-6H3/t11-,12+/m1/s1 |
| InChIKey | KOJVQTRGLADUMS-NEPJUHHUSA-N |
| XLogP | 1.28 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|