C23H22N4 — CID 101351342
3,3-dimethyl-2-N,1-diphenyl-4-N-(pyridin-2-ylmethyl)azetidine-2,4-diimine (PubChem CID 101351342) has the molecular formula C23H22N4 and a molecular weight of 354.46 g/mol. Its IUPAC name is 3,3-dimethyl-2-N,1-diphenyl-4-N-(pyridin-2-ylmethyl)azetidine-2,4-diimine.
| Compound Name | 3,3-dimethyl-2-N,1-diphenyl-4-N-(pyridin-2-ylmethyl)azetidine-2,4-diimine |
|---|---|
| PubChem CID | 101351342 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3,3-dimethyl-2-N,1-diphenyl-4-N-(pyridin-2-ylmethyl)azetidine-2,4-diimine |
| SMILES | CC1(C)/C(=N/Cc2ccccn2)N(c2ccccc2)/C1=N/c1ccccc1 |
| InChI | InChI=1S/C23H22N4/c1-23(2)21(25-17-19-13-9-10-16-24-19)27(20-14-7-4-8-15-20)22(23)26-18-11-5-3-6-12-18/h3-16H,17H2,1-2H3/b25-21-,26-22+ |
| InChIKey | XZTJRCRZFSYMDS-KOUJMYIZSA-N |
| XLogP | 5.26 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|