C15H25N — CID 101352135
5-butyl-2-[(2E,5E)-hepta-2,5-dienyl]-3,4-dihydro-2H-pyrrole (PubChem CID 101352135) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 5-butyl-2-[(2E,5E)-hepta-2,5-dienyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-butyl-2-[(2E,5E)-hepta-2,5-dienyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 101352135 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 5-butyl-2-[(2E,5E)-hepta-2,5-dienyl]-3,4-dihydro-2H-pyrrole |
| SMILES | C/C=C/C/C=C/CC1CCC(CCCC)=N1 |
| InChI | InChI=1S/C15H25N/c1-3-5-7-8-9-11-15-13-12-14(16-15)10-6-4-2/h3,5,8-9,15H,4,6-7,10-13H2,1-2H3/b5-3+,9-8+ |
| InChIKey | JNPJOLJFDRQUOE-YEQUJYSKSA-N |
| XLogP | 4.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|