C16H19NO3S — CID 101352604
N-phenyl-N-prop-2-enylsulfonylcyclohex-3-ene-1-carboxamide (PubChem CID 101352604) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-phenyl-N-prop-2-enylsulfonylcyclohex-3-ene-1-carboxamide.
| Compound Name | N-phenyl-N-prop-2-enylsulfonylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 101352604 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-phenyl-N-prop-2-enylsulfonylcyclohex-3-ene-1-carboxamide |
| SMILES | C=CCS(=O)(=O)N(C(=O)C1CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C16H19NO3S/c1-2-13-21(19,20)17(15-11-7-4-8-12-15)16(18)14-9-5-3-6-10-14/h2-5,7-8,11-12,14H,1,6,9-10,13H2 |
| InChIKey | ODMCPGALBKXXBG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|