C20H14ClN3O2S — CID 10135342
2-[4-(4-chlorophenyl)sulfinylphenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 10135342) has the molecular formula C20H14ClN3O2S and a molecular weight of 395.87 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfinylphenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-(4-chlorophenyl)sulfinylphenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 10135342 |
| Molecular Formula | C20H14ClN3O2S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfinylphenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2nc(-c3ccc(S(=O)c4ccc(Cl)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H14ClN3O2S/c21-14-4-8-16(9-5-14)27(26)15-6-1-12(2-7-15)20-23-17-10-3-13(19(22)25)11-18(17)24-20/h1-11H,(H2,22,25)(H,23,24) |
| InChIKey | XRGRHEXRUIGNAM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |