C20H15ClN4O3S — CID 10180876
2-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 10180876) has the molecular formula C20H15ClN4O3S and a molecular weight of 426.89 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 10180876 |
| Molecular Formula | C20H15ClN4O3S |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2nc(-c3ccc(S(=O)(=O)Nc4ccc(Cl)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H15ClN4O3S/c21-14-4-6-15(7-5-14)25-29(27,28)16-8-1-12(2-9-16)20-23-17-10-3-13(19(22)26)11-18(17)24-20/h1-11,25H,(H2,22,26)(H,23,24) |
| InChIKey | KHJVRUYUSFNQOV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |