C12H19NO4 — CID 101353824
methyl (4E,6E)-2-[(2-methoxy-2-oxoethyl)amino]octa-4,6-dienoate (PubChem CID 101353824) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is methyl (4E,6E)-2-[(2-methoxy-2-oxoethyl)amino]octa-4,6-dienoate.
| Compound Name | methyl (4E,6E)-2-[(2-methoxy-2-oxoethyl)amino]octa-4,6-dienoate |
|---|---|
| PubChem CID | 101353824 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | methyl (4E,6E)-2-[(2-methoxy-2-oxoethyl)amino]octa-4,6-dienoate |
| SMILES | C/C=C/C=C/CC(NCC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H19NO4/c1-4-5-6-7-8-10(12(15)17-3)13-9-11(14)16-2/h4-7,10,13H,8-9H2,1-3H3/b5-4+,7-6+ |
| InChIKey | BXRJMFIGPRUEMN-YTXTXJHMSA-N |
| XLogP | 0.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|