C23H27FN2O4 — CID 142080431
methyl (4E,6Z,8Z)-2-[(5-fluoro-7-methoxy-1,2-dimethylindole-3-carbonyl)amino]deca-4,6,8-trienoate (PubChem CID 142080431) has the molecular formula C23H27FN2O4 and a molecular weight of 414.48 g/mol. Its IUPAC name is methyl (4E,6Z,8Z)-2-[(5-fluoro-7-methoxy-1,2-dimethylindole-3-carbonyl)amino]deca-4,6,8-trienoate.
| Compound Name | methyl (4E,6Z,8Z)-2-[(5-fluoro-7-methoxy-1,2-dimethylindole-3-carbonyl)amino]deca-4,6,8-trienoate |
|---|---|
| PubChem CID | 142080431 |
| Molecular Formula | C23H27FN2O4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | methyl (4E,6Z,8Z)-2-[(5-fluoro-7-methoxy-1,2-dimethylindole-3-carbonyl)amino]deca-4,6,8-trienoate |
| SMILES | C/C=C\C=C/C=C/CC(NC(=O)c1c(C)n(C)c2c(OC)cc(F)cc12)C(=O)OC |
| InChI | InChI=1S/C23H27FN2O4/c1-6-7-8-9-10-11-12-18(23(28)30-5)25-22(27)20-15(2)26(3)21-17(20)13-16(24)14-19(21)29-4/h6-11,13-14,18H,12H2,1-5H3,(H,25,27)/b7-6-,9-8-,11-10+ |
| InChIKey | CDFTUPJNJQJGCP-ZUHOWUEJSA-N |
| XLogP | 3.98 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|