C12H20O2 — CID 101354200
(1R,2R,6R)-1,5,5-trimethyl-2-prop-2-enyl-7-oxabicyclo[4.1.0]heptan-2-ol (PubChem CID 101354200) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (1R,2R,6R)-1,5,5-trimethyl-2-prop-2-enyl-7-oxabicyclo[4.1.0]heptan-2-ol.
| Compound Name | (1R,2R,6R)-1,5,5-trimethyl-2-prop-2-enyl-7-oxabicyclo[4.1.0]heptan-2-ol |
|---|---|
| PubChem CID | 101354200 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (1R,2R,6R)-1,5,5-trimethyl-2-prop-2-enyl-7-oxabicyclo[4.1.0]heptan-2-ol |
| SMILES | C=CC[C@]1(O)CCC(C)(C)[C@H]2O[C@]21C |
| InChI | InChI=1S/C12H20O2/c1-5-6-12(13)8-7-10(2,3)9-11(12,4)14-9/h5,9,13H,1,6-8H2,2-4H3/t9-,11-,12+/m1/s1 |
| InChIKey | MHIMPNNRYOJHHI-JLLWLGSASA-N |
| XLogP | 2.27 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|